When you have many objects on screen, like projectiles, particles, and characters, collision detection gets expensive fast. Brute force checks do not scale well. Spatial partitioning helps with that. In this short post, we look at 2D collision detection, common bottlenecks, and how quadtrees help. We will also walk through a real example using Rust and Macroquad.
Talbe of contents
Why spatial partitioning?
Naive collision detection checks every object against every other object. That becomes impractical quickly. If we use position data, we can skip most checks and focus only on objects that are close.
Spatial partitioning organizes objects in space so we do fewer unnecessary comparisons. It reduces the work needed to answer spatial queries.
For collision detection, we only care about objects likely to collide with a target. There is no reason to check objects that are clearly far away.

Games, simulations, and physics engines use spatial partitioning for fast "what's near me" lookups, including:
- Broad-phase collision detection
- Raycasting acceleration
- Visibility checks
- Frustum culling
Side note: I highly recommend Bob Nystrom's article. I took the image above from it: https://www.gameprogrammingpatterns.com/spatial-partition.html
2D collision detection
As said before, the naive way is to loop through every pair of objects and check if they collide.
for i in 0..entities.len() {
for j in (i+1)..entities.len() {
check_collision(&entities[i], &entities[j]);
}
}
This works fine with a small number of objects. Once object count rises, it becomes a frame killer. 1,000 objects means nearly 500,000 checks every frame.
Total comparisons=2N(N+1)=21000×1001=21001000=500500
Entity 0 checks against [1, 2, ..., 999], Entity 1 checks against [2, ..., 999], and so on. That gives us 1000+998+997+...+1 comparisons. It is the sum of the first N natural numbers, where N is the number of objects. We are dealing with O(n(n+1)/2), which becomes O(n2) for large n.
The major downside is that we do not know which objects are worth checking. We could compute every distance and run collision checks on everything, but that is very inefficient. We need a better way to query nearby objects. Ideally, we want an O(logN) operation that tells us who is nearby.
Useful data structures
Grids
Split the world into uniform, fixed-size cells, like a chessboard covering the entire space. Each object is assigned to the cell it falls into. When querying:
- look only in the object’s cell and its 8 neighbors
- if each cell holds on average k objects, you check at most 9k entries (this would also depend on what kind of bodies you're working with).
Querying cost
Tgrid≈9k⟹O(1) (if k is bounded)

NOTE: Grids are fast and simple, but they don’t scale well when object densities vary a lot. Sparse regions waste memory.
Quadtree
Quadtrees handle uneven density well. They split space more where objects cluster and keep it coarse where few objects exist. This moves complexity into the data structure so queries are cheaper.
Querying cost
Tquadtree≈O(h+m)≈O(logN+m)
where m is the number of reported neighbors (usually small).
Tree traversal
treeheight=h≈log4N=O(logN)

Implementing a quadtree
I built a small demo to show how a quadtree behaves and where it helps. The demo is a Rust + Macroquad program where a floating circle collides with falling particles. Collision resolution is simple on purpose. It uses collision direction plus a damping effect from relative velocity.
We'll be creating
- Falling particles
- A circular rigid body following the user cursor
- Collision resolution between particle and circle using a per-frame quadtree
- Debug visualization of the quadtree on screen

Open the quadtree collision demo video.
Resources
The heart of this system is the QuadNode struct, which simply represents a node in our quadtree:
struct QuadNode {
region: Rect,
points: Vec<(u32, Vec2)>,
regions: Vec<Box<QuadNode>>,
}
Each node contains:
When working with quadtrees you need to care about:
Making regions
This part is straightforward, the code explains it better than words.
impl QuadNode {
fn new(region: Rect) -> Self {
Self {
region,
points: Vec::new(),
regions: QuadNode::make_regions(®ion),
}
}
fn make_regions(region: &Rect) -> Vec<Box<QuadNode>> {
let x = region.x;
let y = region.y;
let hw = region.w / 2.0;
let hh = region.h / 2.0;
vec![
Box::new(QuadNode::new_empty(Rect::new(x, y, hw, hh))),
Box::new(QuadNode::new_empty(Rect::new(x + hw, y, hw, hh))),
Box::new(QuadNode::new_empty(Rect::new(x, y + hh, hw, hh))),
Box::new(QuadNode::new_empty(Rect::new(x + hw, y + hh, hw, hh))),
]
}
}
Adding points
Adding a point is easily solved via recursion:
-
We must first check if the point is contained within the current region (our recursion base case).
-
If the node has no subdivisions and isn't at capacity yet, the point is simply added to the current node's point collection.
- If adding this point would exceed the
QUADTREE_REGION_LIMIT capacity, the node splits into four quadrants and distributes all points plus the new one among the children based on their position.
-
If the node is already subdivided, the point is passed down to the appropriate child node that contains its coordinates.
For this demo, recursion depth stays manageable. If depth becomes a problem, adjust the region limit parameter.
fn add(&mut self, id: u32, position: &Vec2) {
if !self.region.contains(position.clone()) {
return;
}
if self.regions.len() == 0 {
if self.points.len() == QUADTREE_REGION_LIMIT {
self.split();
self.add(id, position);
} else {
self.points.push((id, position.clone()));
}
return;
}
for region in &mut self.regions {
region.add(id, position);
}
}
NOTE: The region limit is an important tradeoff. A higher value means fewer splits and less memory overhead, but heavier collision checks. A lower value means more tree work and more memory use, but fewer collision checks later.
Querying
fn query(&self, query_area: &Rect) -> Vec<(u32, Vec2)> {
let mut ids = Vec::new();
for node in &self.regions {
if node.in_region(query_area) {
if node.regions.len() > 0 {
ids.append(&mut node.query(query_area));
} else {
ids.append(&mut node.points.clone());
}
}
}
ids
}
Quadtree update and collision detection
In the main game loop, we want rebuild the quadtree each frame:
NOTE: quadtrees are not really designed for highly dynamic scenes. They fit static or slowly changing environments better.
For this real time demo, we rebuild the quadtree every frame as objects move.
let mut qtree = QuadNode::new(Rect::new(
0.0,
0.0,
WINDOW_WIDTH as f32,
WINDOW_HEIGHT as f32,
)); // initial region = screen space
for (i, particle) in particles.iter().enumerate() {
qtree.add(i as u32, &particle.entity.position);
}
Collision Detection
I will not go deep into this part because it is straightforward and fits in about 40 lines. What we want is a way to resolve collisions with the player body. My approach was:
-
Query the area the player is currently at (which is naively calculated below)
-
Verify the found particles actually overlap
-
Apply some sort of collision resolution
Here, collision resolution uses the circle surface normal and reflection vector to create a bounce effect.
let player_rect = Rect::new(
player.entity.position.x - player.entity.bound.r,
player.entity.position.y - player.entity.bound.r,
player.entity.bound.r * 2.0,
player.entity.bound.r * 2.0,
);
for i in qtree.query(&player_rect).iter().map(|p| p.0) {
if particles[i as usize]
.entity
.bound
.overlaps(&player.entity.bound)
{
let particle = &mut particles[i as usize];
let particle_pos: Vec2 = particle.entity.bound.point();
let player_pos: Vec2 = player.entity.bound.point();
// normal vector for reflection
let normal = (particle_pos - player_pos).normalize();
let separation_distance = particle.entity.bound.r + player.entity.bound.r;
particle.entity.position = player_pos + (normal * separation_distance);
// get reflection vector using the normal
// v' = v - 2(v·n)n where n is the normal and v is the velocity
particle.velocity = (particle.velocity + player_velocity)
- (normal * (2.0 * particle.velocity.dot(normal)));
// dampening and min velocity
particle.velocity = particle.velocity * 0.3;
if particle.velocity.length() < 100.0 {
particle.velocity = particle.velocity.normalize() * 100.0;
}
// small random variation for a fake natural effect
{
let angle_variation: f32 = rand::gen_range(-0.1, 0.1);
// apply temp rotation matrix
let cos_theta = angle_variation.cos();
let sin_theta = angle_variation.sin();
let vx = particle.velocity.x * cos_theta - particle.velocity.y * sin_theta;
let vy = particle.velocity.x * sin_theta + particle.velocity.y * cos_theta;
particle.velocity = Vec2::new(vx, vy);
}
}
}
You can see how this reduces the number of checks. We no longer check against every particle. We ask the quadtree for the most relevant particles that are likely to collide.
Debug drawing
Since this is Rust, we use traits. A DrawShape trait is used throughout the demo so any drawable type exposes a draw function. Just like Player, we can implement it for QuadNode. We also use recursion here.
trait DrawShape {
fn draw(self: &Self) {}
}
impl DrawShape for QuadNode {
fn draw(&self) {
let r = self.region;
draw_rectangle_lines(r.x, r.y, r.w, r.h, 1.0, GREEN);
for region in &self.regions {
region.draw();
}
}
}
impl DrawShape for Player {
fn draw(&self) {
draw_circle(
self.entity.position.x,
self.entity.position.y,
self.entity.bound.r,
RED,
);
}
}
impl DrawShape for Particle {
fn draw(&self) {
draw_circle(
self.entity.position.x,
self.entity.position.y,
self.entity.bound.r,
WHITE,
);
}
}
User controls implementation
The user interaction system allows for real-time modification of simulation parameters, e.g.:
// adjust player radius with mouse wheel
let (_, mouse_wheel_y) = mouse_wheel();
if mouse_wheel_y != 0.0 {
player.entity.bound.r = (player.entity.bound.r + mouse_wheel_y * 5.0)
.max(30.0)
.min(300.0);
}
Visualizing the quadtree structure
To better understand how the quadtree adapts to particle distribution, we can toggle a debug visualization with the space bar:
impl DrawShape for QuadNode {
fn draw(&self) {
let r = self.region;
draw_rectangle_lines(r.x, r.y, r.w, r.h, 1.0, GREEN);
for region in &self.regions {
region.draw();
}
}
}
// in the draw block
if debug_lines {
qtree.draw();
}
Each quadtree node is outlined in green, showing how space is partitioned dynamically.
Quadtree visualization example:

Green lines reveal how dense areas are subdivided further for efficient collision checks.
You can tweak a few constants to study the quadtree's behavior:
const QUADTREE_REGION_LIMIT: usize = 50; // max points before splitting
const PARTICLE_SPAWN_INTERVAL: f32 = 0.05; // time between particle spawns
const PARTICLE_SPAWN_RATE: f32 = 2000.0; // particles per second
const PARTICLE_RADIUS: f32 = 1.0; // particle size in pixels
Increasing QUADTREE_REGION_LIMIT means fewer splits but heavier queries. Tuning PARTICLE_SPAWN_RATE stresses the system with different loads.
(Dynamic user controls would be cleaner, but I kept this static.)
Displaying FPS
Quick and simple:
draw_text(
format!("{} FPS", get_fps()).as_str(),
WINDOW_WIDTH as f32 - 120.0,
30.0,
30.0,
WHITE,
);
To wrap up
Now that we have a rough idea of how a quadtree is used, I didn’t include the full code here since it’s a bit too long, but you can get it here.
Alternatively, you can copy and paste the following to try the demo yourself:
git clone https://github.com/th3terrorist/quadtree-demo.git
cd quadtree-demo
cargo run --release
Efficient collision detection is mostly about removing redundant checks. Spatial partitioning shifts complexity from runtime brute force to structured queries, which gives near logarithmic lookups in the right scenarios. Thanks for reading.
Credits
All external images used are credited to their original authors.
This article was written as an educational, non-commercial exploration of spatial partitioning techniques.